Difference between revisions of "CPD0-1718"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == * smiles: ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) * common name: ** 7,8-dihyd...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) | ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 165.154 | ** 165.154 | ||
| + | * inchi key: | ||
| + | ** InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** 7,8-dihydropterin | ||
* Synonym(s): | * Synonym(s): | ||
** dihydropterin | ** dihydropterin | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.58752.html 58752] | ** [http://www.chemspider.com/Chemical-Structure.58752.html 58752] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65260 65260] | ||
{{#set: smiles=C1(=NC2(=C(NC1)N=C(N)NC(=O)2))}} | {{#set: smiles=C1(=NC2(=C(NC1)N=C(N)NC(=O)2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=165.154 }} | {{#set: molecular weight=165.154 }} | ||
| + | {{#set: inchi key=InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=7,8-dihydropterin}} | ||
{{#set: common name=dihydropterin|H2-pterin}} | {{#set: common name=dihydropterin|H2-pterin}} | ||
{{#set: consumed by=RXN-15261}} | {{#set: consumed by=RXN-15261}} | ||
Latest revision as of 12:17, 10 January 2019
Contents
Metabolite CPD0-1718
- smiles:
- C1(=NC2(=C(NC1)N=C(N)NC(=O)2))
- molecular weight:
- 165.154
- inchi key:
- InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N
- common name:
- 7,8-dihydropterin
- Synonym(s):
- dihydropterin
- H2-pterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
