Difference between revisions of "CPD-12826"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3)) | ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3)) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 439.387 | ** 439.387 | ||
+ | * inchi key: | ||
+ | ** InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-L | ||
+ | * common name: | ||
+ | ** folate | ||
* Synonym(s): | * Synonym(s): | ||
** folic acid | ** folic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
* [[DHFOR]] | * [[DHFOR]] | ||
− | * [[ | + | * [[THFOR1]] |
* [[THFOR2]] | * [[THFOR2]] | ||
+ | * [[FOLR2]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62501 62501] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549092 1549092] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549092 1549092] | ||
+ | * HMDB : HMDB00121 | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.1266060.html 1266060] | ** [http://www.chemspider.com/Chemical-Structure.1266060.html 1266060] | ||
− | * | + | * GO-TERMS : (REFMET "Folic acid" NIL midford 3701443689 NIL NIL) |
− | + | ||
− | + | ||
{{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))}} | {{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))}} | ||
− | |||
− | |||
{{#set: molecular weight=439.387 }} | {{#set: molecular weight=439.387 }} | ||
+ | {{#set: inchi key=InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-L}} | ||
+ | {{#set: common name=folate}} | ||
{{#set: common name=folic acid}} | {{#set: common name=folic acid}} | ||
− | {{#set: consumed by= | + | {{#set: consumed by=DHFOR|THFOR1|THFOR2|FOLR2}} |
Latest revision as of 11:41, 10 January 2019
Contents
Metabolite CPD-12826
- smiles:
- C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))
- molecular weight:
- 439.387
- inchi key:
- InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-L
- common name:
- folate
- Synonym(s):
- folic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEBI:
- PUBCHEM:
- HMDB : HMDB00121
- CHEMSPIDER:
- GO-TERMS : (REFMET "Folic acid" NIL midford 3701443689 NIL NIL)
"C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))" cannot be used as a page name in this wiki.