Difference between revisions of "CPD-15699"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * common name: ** aldehydo-L-arabin...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** [CH](=O)C(O)C(O)C(O)CO | ** [CH](=O)C(O)C(O)C(O)CO | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 150.131 | ** 150.131 | ||
| + | * inchi key: | ||
| + | ** InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N | ||
| + | * common name: | ||
| + | ** aldehydo-L-arabinose | ||
* Synonym(s): | * Synonym(s): | ||
| Line 15: | Line 15: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[RXN-14102]] | * [[RXN-14102]] | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460291 5460291] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476] | ** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476] | ||
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}} | {{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}} | ||
| − | |||
| − | |||
{{#set: molecular weight=150.131 }} | {{#set: molecular weight=150.131 }} | ||
| − | {{#set: reversible reaction associated=RXN-14102 | + | {{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N}} |
| + | {{#set: common name=aldehydo-L-arabinose}} | ||
| + | {{#set: reversible reaction associated=RXN-14102}} | ||
Latest revision as of 11:44, 10 January 2019
Contents
Metabolite CPD-15699
- smiles:
- [CH](=O)C(O)C(O)C(O)CO
- molecular weight:
- 150.131
- inchi key:
- InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
- common name:
- aldehydo-L-arabinose
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.
