Difference between revisions of "CPD-13559"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * common name: ** α-D-man...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(C(O)C(O)C(O)C(O)O1) | ** C(O)C1(C(O)C(O)C(O)C(O)O1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 180.157 | ** 180.157 | ||
+ | * inchi key: | ||
+ | ** InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N | ||
+ | * common name: | ||
+ | ** α-D-mannopyranose | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[3.2.1.24-RXN]] | * [[3.2.1.24-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * METABOLIGHTS : MTBLC28729 |
− | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28729 28729] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28729 28729] | ||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00936 C00936] | ** [http://www.genome.jp/dbget-bin/www_bget?C00936 C00936] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=185698 185698] | ||
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O)O1)}} | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O)O1)}} | ||
− | |||
− | |||
{{#set: molecular weight=180.157 }} | {{#set: molecular weight=180.157 }} | ||
− | {{#set: produced by= | + | {{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N}} |
+ | {{#set: common name=α-D-mannopyranose}} | ||
+ | {{#set: produced by=3.2.1.24-RXN}} |
Latest revision as of 13:48, 10 January 2019
Contents
Metabolite CPD-13559
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O)O1)
- molecular weight:
- 180.157
- inchi key:
- InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N
- common name:
- α-D-mannopyranose
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links