Difference between revisions of "CPD-474"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * c...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) | ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 303.248 | ** 303.248 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M | ||
| + | * common name: | ||
| + | ** (+)-taxifolin | ||
* Synonym(s): | * Synonym(s): | ||
** trans dihydroquercetin | ** trans dihydroquercetin | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-600]] | * [[RXN-600]] | ||
| + | * [[RXN-527]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-7775]] | * [[RXN-7775]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * REFMET : Taxifolin |
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891] | ||
| + | * CAS : 480-18-2 | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58329 58329] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58329 58329] | ||
| Line 29: | Line 30: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617] | ** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617] | ||
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}} | {{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=303.248 }} | {{#set: molecular weight=303.248 }} | ||
| + | {{#set: inchi key=InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M}} | ||
| + | {{#set: common name=(+)-taxifolin}} | ||
{{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}} | {{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}} | ||
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-600|RXN-527}} |
{{#set: produced by=RXN-7775}} | {{#set: produced by=RXN-7775}} | ||
Latest revision as of 12:55, 10 January 2019
Contents
Metabolite CPD-474
- smiles:
- C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
- molecular weight:
- 303.248
- inchi key:
- InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
- common name:
- (+)-taxifolin
- Synonym(s):
- trans dihydroquercetin
- (+)-dihydroquercetin
- taxifolin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))" cannot be used as a page name in this wiki.
