Difference between revisions of "CPD-10818"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10818 CPD-10818] == * smiles: ** C=C(CCOP(=O)([O-])[O-])C * common name: ** isopentenyl pho...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=C(CCOP(=O)([O-])[O-])C | ** C=C(CCOP(=O)([O-])[O-])C | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 164.097 | ** 164.097 | ||
+ | * inchi key: | ||
+ | ** InChIKey=QMZRXYCCCYYMHF-UHFFFAOYSA-L | ||
+ | * common name: | ||
+ | ** isopentenyl phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** isopentenyl-P | ** isopentenyl-P | ||
Line 17: | Line 17: | ||
* [[RXN-10068]] | * [[RXN-10068]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65078 65078] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65078 65078] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123422 44123422] | ||
{{#set: smiles=C=C(CCOP(=O)([O-])[O-])C}} | {{#set: smiles=C=C(CCOP(=O)([O-])[O-])C}} | ||
− | |||
− | |||
{{#set: molecular weight=164.097 }} | {{#set: molecular weight=164.097 }} | ||
+ | {{#set: inchi key=InChIKey=QMZRXYCCCYYMHF-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=isopentenyl phosphate}} | ||
{{#set: common name=isopentenyl-P}} | {{#set: common name=isopentenyl-P}} | ||
{{#set: reversible reaction associated=RXN-10068}} | {{#set: reversible reaction associated=RXN-10068}} |
Latest revision as of 13:55, 10 January 2019
Contents
Metabolite CPD-10818
- smiles:
- C=C(CCOP(=O)([O-])[O-])C
- molecular weight:
- 164.097
- inchi key:
- InChIKey=QMZRXYCCCYYMHF-UHFFFAOYSA-L
- common name:
- isopentenyl phosphate
- Synonym(s):
- isopentenyl-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(CCOP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.