Difference between revisions of "CPDQT-39"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == * smiles: ** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(6'-me...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] | ** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 262.32 | ** 262.32 | ||
+ | * inchi key: | ||
+ | ** InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L | ||
+ | * common name: | ||
+ | ** 3-[(6'-methylthio)hexyl]malate | ||
* Synonym(s): | * Synonym(s): | ||
− | ** 3-(6'-methylthio) | + | ** 3-[(6'-methylthio)hexyl]malic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
Line 21: | Line 21: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237339 44237339] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237339 44237339] | ||
{{#set: smiles=CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} | {{#set: smiles=CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=262.32 }} | {{#set: molecular weight=262.32 }} | ||
− | {{#set: common name=3-(6'-methylthio) | + | {{#set: inchi key=InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L}} |
+ | {{#set: common name=3-[(6'-methylthio)hexyl]malate}} | ||
+ | {{#set: common name=3-[(6'-methylthio)hexyl]malic acid}} | ||
{{#set: consumed by=RXNQT-4174}} | {{#set: consumed by=RXNQT-4174}} | ||
{{#set: reversible reaction associated=RXN-18202}} | {{#set: reversible reaction associated=RXN-18202}} |
Latest revision as of 14:09, 10 January 2019
Contents
Metabolite CPDQT-39
- smiles:
- CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
- molecular weight:
- 262.32
- inchi key:
- InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L
- common name:
- 3-[(6'-methylthio)hexyl]malate
- Synonym(s):
- 3-[(6'-methylthio)hexyl]malic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
"3-[(6'-methylthio)hexyl]malate" cannot be used as a page name in this wiki.
"3-[(6'-methylthio)hexyl]malic acid" cannot be used as a page name in this wiki.