Difference between revisions of "CPD-1823"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1823 CPD-1823] == * smiles: ** CN1(C=NC=C1CC(C(=O)[O-])[N+]) * common name: ** Nπ-methyl...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CN1(C=NC=C1CC(C(=O)[O-])[N+]) | ** CN1(C=NC=C1CC(C(=O)[O-])[N+]) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 169.183 | ** 169.183 | ||
+ | * inchi key: | ||
+ | ** InChIKey=JDHILDINMRGULE-LURJTMIESA-N | ||
+ | * common name: | ||
+ | ** Nπ-methyl-L-histidine | ||
* Synonym(s): | * Synonym(s): | ||
** 1-methyl-histidine | ** 1-methyl-histidine | ||
Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27596 27596] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971061 6971061] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971061 6971061] | ||
* HMDB : HMDB00479 | * HMDB : HMDB00479 | ||
− | * | + | * REFMET : 3-Methylhistidine |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01152 C01152] | ** [http://www.genome.jp/dbget-bin/www_bget?C01152 C01152] | ||
{{#set: smiles=CN1(C=NC=C1CC(C(=O)[O-])[N+])}} | {{#set: smiles=CN1(C=NC=C1CC(C(=O)[O-])[N+])}} | ||
− | |||
− | |||
{{#set: molecular weight=169.183 }} | {{#set: molecular weight=169.183 }} | ||
+ | {{#set: inchi key=InChIKey=JDHILDINMRGULE-LURJTMIESA-N}} | ||
+ | {{#set: common name=Nπ-methyl-L-histidine}} | ||
{{#set: common name=1-methyl-histidine|(2S)-2-amino-3-(1-methyl-1H-imidazol-5-yl)propanoic acid}} | {{#set: common name=1-methyl-histidine|(2S)-2-amino-3-(1-methyl-1H-imidazol-5-yl)propanoic acid}} | ||
{{#set: produced by=X-METHYL-HIS-DIPEPTIDASE-RXN}} | {{#set: produced by=X-METHYL-HIS-DIPEPTIDASE-RXN}} |
Latest revision as of 14:12, 10 January 2019
Contents
Metabolite CPD-1823
- smiles:
- CN1(C=NC=C1CC(C(=O)[O-])[N+])
- molecular weight:
- 169.183
- inchi key:
- InChIKey=JDHILDINMRGULE-LURJTMIESA-N
- common name:
- Nπ-methyl-L-histidine
- Synonym(s):
- 1-methyl-histidine
- (2S)-2-amino-3-(1-methyl-1H-imidazol-5-yl)propanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CN1(C=NC=C1CC(C(=O)[O-])[N+])" cannot be used as a page name in this wiki.