Difference between revisions of "CPD-490"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] == * smiles: ** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O * common name: ** α-...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O | ** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 228.095 | ** 228.095 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L | ||
| + | * common name: | ||
| + | ** α-D-xylose 1-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
* [[2.7.7.11-RXN]] | * [[2.7.7.11-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57559 57559] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57559 57559] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202995 25202995] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03737 C03737] | ** [http://www.genome.jp/dbget-bin/www_bget?C03737 C03737] | ||
{{#set: smiles=C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O}} | {{#set: smiles=C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=228.095 }} | {{#set: molecular weight=228.095 }} | ||
| + | {{#set: inchi key=InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L}} | ||
| + | {{#set: common name=α-D-xylose 1-phosphate}} | ||
{{#set: reversible reaction associated=2.7.7.11-RXN}} | {{#set: reversible reaction associated=2.7.7.11-RXN}} | ||
Latest revision as of 13:17, 10 January 2019
Contents
Metabolite CPD-490
- smiles:
- C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O
- molecular weight:
- 228.095
- inchi key:
- InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L
- common name:
- α-D-xylose 1-phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O" cannot be used as a page name in this wiki.
