Difference between revisions of "2-KETO-3-DEOXY-6-P-GLUCONATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-6-P-GLUCONATE 2-KETO-3-DEOXY-6-P-GLUCONATE] == * smiles: ** C(=O)([O-])C(=O)CC(O...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)([O-])C(=O)CC(O)C(O)COP([O-])(=O)[O-] | ** C(=O)([O-])C(=O)CC(O)C(O)COP([O-])(=O)[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 255.098 | ** 255.098 | ||
+ | * inchi key: | ||
+ | ** InChIKey=OVPRPPOVAXRCED-WVZVXSGGSA-K | ||
+ | * common name: | ||
+ | ** 2-dehydro-3-deoxy-D-gluconate 6-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** 2-keto-3-deoxy-6-phospho-D-gluconate | ** 2-keto-3-deoxy-6-phospho-D-gluconate | ||
Line 22: | Line 22: | ||
** 3-deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate | ** 3-deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate | ||
** 3-deoxy-D-erythro-hex-2-ulosonate-6-phosphate | ** 3-deoxy-D-erythro-hex-2-ulosonate-6-phosphate | ||
+ | ** KDPG | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
Line 29: | Line 30: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229082 44229082] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229082 44229082] | ||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57569 57569] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57569 57569] | ||
+ | * CAS : 27244-54-8 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04442 C04442] | ||
+ | * HMDB : HMDB01376 | ||
* BIGG : 2ddg6p | * BIGG : 2ddg6p | ||
{{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)COP([O-])(=O)[O-]}} | {{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)COP([O-])(=O)[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=255.098 }} | {{#set: molecular weight=255.098 }} | ||
− | {{#set: common name=2-keto-3-deoxy-6-phospho-D-gluconate|2-dehydro-3-deoxy-6-phospho-D-gluconate|2-keto-3-deoxy-6-phospho-gluconate|6-phospho-2-dehydro-3-deoxy-D-gluconate|2-keto-3-deoxy-6-phosphogluconate|2-keto-3-deoxy-6-P-gluconate|6-p-2-k-3-deo-gluconate|6-phospho-2-keto-3-deoxygluconate|6-phospho-2-dehydro-3-deoxygluconate|2-keto-3-deoxygluconate-6-P|3-deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate|3-deoxy-D-erythro-hex-2-ulosonate-6-phosphate}} | + | {{#set: inchi key=InChIKey=OVPRPPOVAXRCED-WVZVXSGGSA-K}} |
+ | {{#set: common name=2-dehydro-3-deoxy-D-gluconate 6-phosphate}} | ||
+ | {{#set: common name=2-keto-3-deoxy-6-phospho-D-gluconate|2-dehydro-3-deoxy-6-phospho-D-gluconate|2-keto-3-deoxy-6-phospho-gluconate|6-phospho-2-dehydro-3-deoxy-D-gluconate|2-keto-3-deoxy-6-phosphogluconate|2-keto-3-deoxy-6-P-gluconate|6-p-2-k-3-deo-gluconate|6-phospho-2-keto-3-deoxygluconate|6-phospho-2-dehydro-3-deoxygluconate|2-keto-3-deoxygluconate-6-P|3-deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate|3-deoxy-D-erythro-hex-2-ulosonate-6-phosphate|KDPG}} | ||
{{#set: consumed by=KDPGALDOL-RXN}} | {{#set: consumed by=KDPGALDOL-RXN}} | ||
{{#set: produced by=PGLUCONDEHYDRAT-RXN}} | {{#set: produced by=PGLUCONDEHYDRAT-RXN}} |
Latest revision as of 13:17, 10 January 2019
Contents
Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE
- smiles:
- C(=O)([O-])C(=O)CC(O)C(O)COP([O-])(=O)[O-]
- molecular weight:
- 255.098
- inchi key:
- InChIKey=OVPRPPOVAXRCED-WVZVXSGGSA-K
- common name:
- 2-dehydro-3-deoxy-D-gluconate 6-phosphate
- Synonym(s):
- 2-keto-3-deoxy-6-phospho-D-gluconate
- 2-dehydro-3-deoxy-6-phospho-D-gluconate
- 2-keto-3-deoxy-6-phospho-gluconate
- 6-phospho-2-dehydro-3-deoxy-D-gluconate
- 2-keto-3-deoxy-6-phosphogluconate
- 2-keto-3-deoxy-6-P-gluconate
- 6-p-2-k-3-deo-gluconate
- 6-phospho-2-keto-3-deoxygluconate
- 6-phospho-2-dehydro-3-deoxygluconate
- 2-keto-3-deoxygluconate-6-P
- 3-deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate
- 3-deoxy-D-erythro-hex-2-ulosonate-6-phosphate
- KDPG
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(=O)CC(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.