Difference between revisions of "CPD-13670"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13670 CPD-13670] == * smiles: ** CC1(C(CCC2(C3(C(CCC12)(C4(C(=CC(=O)3)C5(C(CC4)(CCC(C5)(CO)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC1(C(CCC2(C3(C(CCC12)(C4(C(=CC(=O)3)C5(C(CC4)(CCC(C5)(CO)C)C))C)C))C)O)C | ** CC1(C(CCC2(C3(C(CCC12)(C4(C(=CC(=O)3)C5(C(CC4)(CCC(C5)(CO)C)C))C)C))C)O)C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 456.707 | ** 456.707 | ||
| + | * inchi key: | ||
| + | ** InChIKey=JCGXIYQLRYPHDG-ZBYJLJTQSA-N | ||
| + | * common name: | ||
| + | ** 30-hydroxy-11-oxo-β-amyrin | ||
* Synonym(s): | * Synonym(s): | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71576 71576] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71576 71576] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659240 90659240] | ||
{{#set: smiles=CC1(C(CCC2(C3(C(CCC12)(C4(C(=CC(=O)3)C5(C(CC4)(CCC(C5)(CO)C)C))C)C))C)O)C}} | {{#set: smiles=CC1(C(CCC2(C3(C(CCC12)(C4(C(=CC(=O)3)C5(C(CC4)(CCC(C5)(CO)C)C))C)C))C)O)C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=456.707 }} | {{#set: molecular weight=456.707 }} | ||
| + | {{#set: inchi key=InChIKey=JCGXIYQLRYPHDG-ZBYJLJTQSA-N}} | ||
| + | {{#set: common name=30-hydroxy-11-oxo-β-amyrin}} | ||
{{#set: consumed by=RXN-13493}} | {{#set: consumed by=RXN-13493}} | ||
{{#set: produced by=RXN-13492}} | {{#set: produced by=RXN-13492}} | ||
Latest revision as of 13:22, 10 January 2019
Contents
Metabolite CPD-13670
- smiles:
- CC1(C(CCC2(C3(C(CCC12)(C4(C(=CC(=O)3)C5(C(CC4)(CCC(C5)(CO)C)C))C)C))C)O)C
- molecular weight:
- 456.707
- inchi key:
- InChIKey=JCGXIYQLRYPHDG-ZBYJLJTQSA-N
- common name:
- 30-hydroxy-11-oxo-β-amyrin
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
