Difference between revisions of "CPD-8564"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == * smiles: ** C(O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin light-cha...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == | ||
* smiles: | * smiles: | ||
| − | ** C(O) | + | ** C(=O)([a protein])C(N[a protein])CO |
* common name: | * common name: | ||
| − | ** myosin light-chain | + | ** a [myosin light-chain] L-serine |
* Synonym(s): | * Synonym(s): | ||
| Line 14: | Line 14: | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01003 C01003] | ** [http://www.genome.jp/dbget-bin/www_bget?C01003 C01003] | ||
| − | {{#set: smiles=C(O) | + | {{#set: smiles=C(=O)([a protein])C(N[a protein])CO}} |
| − | {{#set: common name=myosin light-chain}} | + | {{#set: common name=a [myosin light-chain] L-serine}} |
{{#set: reversible reaction associated=2.7.11.18-RXN}} | {{#set: reversible reaction associated=2.7.11.18-RXN}} | ||
Latest revision as of 13:26, 10 January 2019
Contents
Metabolite CPD-8564
- smiles:
- C(=O)([a protein])C(N[a protein])CO
- common name:
- a [myosin light-chain] L-serine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIGAND-CPD:
"C(=O)([a protein])C(N[a protein])CO" cannot be used as a page name in this wiki.
"a [myosin light-chain] L-serine" cannot be used as a page name in this wiki.
