Difference between revisions of "CPD-9861"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9861 CPD-9861] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=...") |
|||
Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9861 CPD-9861] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9861 CPD-9861] == | ||
* smiles: | * smiles: | ||
− | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C( | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(O)C(OC)=C(O)C(O)=C(C)1) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* molecular weight: | * molecular weight: | ||
** 646.992 | ** 646.992 | ||
+ | * inchi key: | ||
+ | ** InChIKey=OHBHBMXNJCUMCR-DKCCAHEHSA-N | ||
+ | * common name: | ||
+ | ** 3-demethylubiquinol-7 | ||
* Synonym(s): | * Synonym(s): | ||
** 2-heptaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinol | ** 2-heptaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinol | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84431 84431] | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986126 50986126] |
− | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C( | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(O)C(OC)=C(O)C(O)=C(C)1)}} |
− | + | ||
− | + | ||
{{#set: molecular weight=646.992 }} | {{#set: molecular weight=646.992 }} | ||
+ | {{#set: inchi key=InChIKey=OHBHBMXNJCUMCR-DKCCAHEHSA-N}} | ||
+ | {{#set: common name=3-demethylubiquinol-7}} | ||
{{#set: common name=2-heptaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinol}} | {{#set: common name=2-heptaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinol}} | ||
{{#set: consumed by=RXN-9229}} | {{#set: consumed by=RXN-9229}} |
Latest revision as of 13:27, 10 January 2019
Contents
Metabolite CPD-9861
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(O)C(OC)=C(O)C(O)=C(C)1)
- molecular weight:
- 646.992
- inchi key:
- InChIKey=OHBHBMXNJCUMCR-DKCCAHEHSA-N
- common name:
- 3-demethylubiquinol-7
- Synonym(s):
- 2-heptaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links