Difference between revisions of "GLYCEROPHOSPHOGLYCEROL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROPHOSPHOGLYCEROL GLYCEROPHOSPHOGLYCEROL] == * smiles: ** C(C(COP(OCC(CO)O)([O-])=O)O)O *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C(COP(OCC(CO)O)([O-])=O)O)O | ** C(C(COP(OCC(CO)O)([O-])=O)O)O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 245.146 | ** 245.146 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LLCSXHMJULHSJN-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** glycerophosphoglycerol | ||
* Synonym(s): | * Synonym(s): | ||
** diglycerol phosphate | ** diglycerol phosphate | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61933 61933] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61933 61933] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202983 25202983] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03274 C03274] | ** [http://www.genome.jp/dbget-bin/www_bget?C03274 C03274] | ||
| + | * BIGG : g3pg | ||
{{#set: smiles=C(C(COP(OCC(CO)O)([O-])=O)O)O}} | {{#set: smiles=C(C(COP(OCC(CO)O)([O-])=O)O)O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=245.146 }} | {{#set: molecular weight=245.146 }} | ||
| + | {{#set: inchi key=InChIKey=LLCSXHMJULHSJN-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=glycerophosphoglycerol}} | ||
{{#set: common name=diglycerol phosphate|bis(2,3-dihydroxypropyl) phosphate}} | {{#set: common name=diglycerol phosphate|bis(2,3-dihydroxypropyl) phosphate}} | ||
{{#set: consumed by=RXN-14073}} | {{#set: consumed by=RXN-14073}} | ||
Latest revision as of 13:28, 10 January 2019
Contents
Metabolite GLYCEROPHOSPHOGLYCEROL
- smiles:
- C(C(COP(OCC(CO)O)([O-])=O)O)O
- molecular weight:
- 245.146
- inchi key:
- InChIKey=LLCSXHMJULHSJN-UHFFFAOYSA-M
- common name:
- glycerophosphoglycerol
- Synonym(s):
- diglycerol phosphate
- bis(2,3-dihydroxypropyl) phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(COP(OCC(CO)O)([O-])=O)O)O" cannot be used as a page name in this wiki.
