Difference between revisions of "CPD-7088"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == * smiles: ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) * co...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) | ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 322.271 | ** 322.271 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N | ||
+ | * common name: | ||
+ | ** (2R,3S,4S)-leucodelphinidin | ||
* Synonym(s): | * Synonym(s): | ||
** (2R,3S,4S)-leucoefdin | ** (2R,3S,4S)-leucoefdin | ||
Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * METABOLIGHTS : MTBLC71216 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440835 440835] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6417 6417] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6417 6417] | ||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05909 C05909] | ** [http://www.genome.jp/dbget-bin/www_bget?C05909 C05909] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.2338991.html 2338991] | ||
{{#set: smiles=C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O)}} | {{#set: smiles=C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O)}} | ||
− | |||
− | |||
{{#set: molecular weight=322.271 }} | {{#set: molecular weight=322.271 }} | ||
+ | {{#set: inchi key=InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N}} | ||
+ | {{#set: common name=(2R,3S,4S)-leucodelphinidin}} | ||
{{#set: common name=(2R,3S,4S)-leucoefdin|(2R,3S,4S)-leucodelfinidin}} | {{#set: common name=(2R,3S,4S)-leucoefdin|(2R,3S,4S)-leucodelfinidin}} | ||
{{#set: produced by=RXN-7784}} | {{#set: produced by=RXN-7784}} |
Latest revision as of 13:42, 10 January 2019
Contents
Metabolite CPD-7088
- smiles:
- C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O)
- molecular weight:
- 322.271
- inchi key:
- InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N
- common name:
- (2R,3S,4S)-leucodelphinidin
- Synonym(s):
- (2R,3S,4S)-leucoefdin
- (2R,3S,4S)-leucodelfinidin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links