Difference between revisions of "CPD-11608"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11608 CPD-11608] == * smiles: ** CCC(C(C)C)CCC(C)[CH]4(CC[CH]5([CH]3(CC=C2(CC(OC1(OC(CO)C(O...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC(C(C)C)CCC(C)[CH]4(CC[CH]5([CH]3(CC=C2(CC(OC1(OC(CO)C(O)C(O)C(O)1))CCC(C)2[CH]3CCC(C)45)))) | ** CCC(C(C)C)CCC(C)[CH]4(CC[CH]5([CH]3(CC=C2(CC(OC1(OC(CO)C(O)C(O)C(O)1))CCC(C)2[CH]3CCC(C)45)))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 576.855 | ** 576.855 | ||
| + | * inchi key: | ||
| + | ** InChIKey=NPJICTMALKLTFW-KUENWNPSSA-N | ||
| + | * common name: | ||
| + | ** β-sitosterol 3-O-β-D-glucoside | ||
* Synonym(s): | * Synonym(s): | ||
** β-sitosterol glucoside | ** β-sitosterol glucoside | ||
| Line 21: | Line 21: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * METABOLIGHTS : MTBLC67554 |
| − | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67554 67554] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67554 67554] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12309073 12309073] | ||
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]4(CC[CH]5([CH]3(CC=C2(CC(OC1(OC(CO)C(O)C(O)C(O)1))CCC(C)2[CH]3CCC(C)45))))}} | {{#set: smiles=CCC(C(C)C)CCC(C)[CH]4(CC[CH]5([CH]3(CC=C2(CC(OC1(OC(CO)C(O)C(O)C(O)1))CCC(C)2[CH]3CCC(C)45))))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=576.855 }} | {{#set: molecular weight=576.855 }} | ||
| + | {{#set: inchi key=InChIKey=NPJICTMALKLTFW-KUENWNPSSA-N}} | ||
| + | {{#set: common name=β-sitosterol 3-O-β-D-glucoside}} | ||
{{#set: common name=β-sitosterol glucoside|O-glucosyl-β-sitosterol|β-sitosterol-beta-D-glucopyranoside|daucosterol|3-O-β-D-glucosyl-β-sitosterol}} | {{#set: common name=β-sitosterol glucoside|O-glucosyl-β-sitosterol|β-sitosterol-beta-D-glucopyranoside|daucosterol|3-O-β-D-glucosyl-β-sitosterol}} | ||
{{#set: produced by=RXN-12128}} | {{#set: produced by=RXN-12128}} | ||
Latest revision as of 14:45, 10 January 2019
Contents
Metabolite CPD-11608
- smiles:
- CCC(C(C)C)CCC(C)[CH]4(CC[CH]5([CH]3(CC=C2(CC(OC1(OC(CO)C(O)C(O)C(O)1))CCC(C)2[CH]3CCC(C)45))))
- molecular weight:
- 576.855
- inchi key:
- InChIKey=NPJICTMALKLTFW-KUENWNPSSA-N
- common name:
- β-sitosterol 3-O-β-D-glucoside
- Synonym(s):
- β-sitosterol glucoside
- O-glucosyl-β-sitosterol
- β-sitosterol-beta-D-glucopyranoside
- daucosterol
- 3-O-β-D-glucosyl-β-sitosterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(C(C)C)CCC(C)[CH]4(CC[CH]5([CH]3(CC=C2(CC(OC1(OC(CO)C(O)C(O)C(O)1))CCC(C)2[CH]3CCC(C)45))))" cannot be used as a page name in this wiki.
