Difference between revisions of "CPD-12581"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12581 CPD-12581] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCSCC([N+])C([O-])=O * common name:...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12581 CPD-12581] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12581 CPD-12581] == | ||
* smiles: | * smiles: | ||
| − | ** CC(C)=CCCC(C)=CCCC(C)=CCSCC([N+])C([O-] | + | ** CC(C)=CCCC(C)=CCCC(C)=CCSCC([N+])C(=O)[O-] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
** 325.508 | ** 325.508 | ||
| + | * inchi key: | ||
| + | ** InChIKey=SYSLNQMKLROGCL-BCYUYYMPSA-N | ||
| + | * common name: | ||
| + | ** S-(2E,6E)-farnesyl-L-cysteine | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** S-farnesylcysteine | ||
** L-Cysteine, S-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)- | ** L-Cysteine, S-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)- | ||
** S-all-trans-farnesyl cysteine | ** S-all-trans-farnesyl cysteine | ||
| Line 21: | Line 22: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62141 62141] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62141 62141] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926172 46926172] | ||
* HMDB : HMDB11627 | * HMDB : HMDB11627 | ||
| − | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCSCC([N+])C([O-] | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCSCC([N+])C(=O)[O-]}} |
| − | + | ||
| − | + | ||
{{#set: molecular weight=325.508 }} | {{#set: molecular weight=325.508 }} | ||
| − | {{#set: common name=L-Cysteine, S-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-|S-all-trans-farnesyl cysteine|S-trans, trans-farnesylcysteine|2-trans-6- trans-farnesylcysteine|S-all-trans-farnesylcysteine}} | + | {{#set: inchi key=InChIKey=SYSLNQMKLROGCL-BCYUYYMPSA-N}} |
| + | {{#set: common name=S-(2E,6E)-farnesyl-L-cysteine}} | ||
| + | {{#set: common name=S-farnesylcysteine|L-Cysteine, S-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-|S-all-trans-farnesyl cysteine|S-trans, trans-farnesylcysteine|2-trans-6- trans-farnesylcysteine|S-all-trans-farnesylcysteine}} | ||
{{#set: consumed by=RXN-11623}} | {{#set: consumed by=RXN-11623}} | ||
Latest revision as of 10:49, 10 January 2019
Contents
Metabolite CPD-12581
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCSCC([N+])C(=O)[O-]
- molecular weight:
- 325.508
- inchi key:
- InChIKey=SYSLNQMKLROGCL-BCYUYYMPSA-N
- common name:
- S-(2E,6E)-farnesyl-L-cysteine
- Synonym(s):
- S-farnesylcysteine
- L-Cysteine, S-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-
- S-all-trans-farnesyl cysteine
- S-trans, trans-farnesylcysteine
- 2-trans-6- trans-farnesylcysteine
- S-all-trans-farnesylcysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCSCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.
