Difference between revisions of "CPD-12897"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == * smiles: ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 915.695 | ** 915.695 | ||
+ | * inchi key: | ||
+ | ** InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J | ||
+ | * common name: | ||
+ | ** 7-methyl-3-oxooct-6-enoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
** 7-methyl-3-oxo-6-octenoyl-CoA | ** 7-methyl-3-oxo-6-octenoyl-CoA | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71410 71410] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986200 50986200] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986200 50986200] | ||
* HMDB : HMDB60421 | * HMDB : HMDB60421 | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16466 C16466] | ** [http://www.genome.jp/dbget-bin/www_bget?C16466 C16466] | ||
{{#set: smiles=CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=915.695 }} | {{#set: molecular weight=915.695 }} | ||
+ | {{#set: inchi key=InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J}} | ||
+ | {{#set: common name=7-methyl-3-oxooct-6-enoyl-CoA}} | ||
{{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA}} | {{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA}} | ||
{{#set: consumed by=RXN-11917}} | {{#set: consumed by=RXN-11917}} |
Latest revision as of 13:49, 10 January 2019
Contents
Metabolite CPD-12897
- smiles:
- CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 915.695
- inchi key:
- InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J
- common name:
- 7-methyl-3-oxooct-6-enoyl-CoA
- Synonym(s):
- 7-methyl-3-oxo-6-octenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.