Difference between revisions of "L-IDONATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-IDONATE L-IDONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** L-idonate...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] | ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 195.149 | ** 195.149 | ||
+ | * inchi key: | ||
+ | ** InChIKey=RGHNJXZEOKUKBD-SKNVOMKLSA-M | ||
+ | * common name: | ||
+ | ** L-idonate | ||
* Synonym(s): | * Synonym(s): | ||
** L-idonic acid | ** L-idonic acid | ||
Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.4573673.html 4573673] | ** [http://www.chemspider.com/Chemical-Structure.4573673.html 4573673] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459956 5459956] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17796 17796] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17796 17796] | ||
+ | * CAS : 1114-17-6 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00770 C00770] | ||
* BIGG : idon__L | * BIGG : idon__L | ||
{{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | {{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=195.149 }} | {{#set: molecular weight=195.149 }} | ||
+ | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-SKNVOMKLSA-M}} | ||
+ | {{#set: common name=L-idonate}} | ||
{{#set: common name=L-idonic acid|(R)-idonate}} | {{#set: common name=L-idonic acid|(R)-idonate}} | ||
{{#set: consumed by=RXN-12107}} | {{#set: consumed by=RXN-12107}} |
Latest revision as of 15:02, 10 January 2019
Contents
Metabolite L-IDONATE
- smiles:
- C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
- molecular weight:
- 195.149
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-SKNVOMKLSA-M
- common name:
- L-idonate
- Synonym(s):
- L-idonic acid
- (R)-idonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.