Difference between revisions of "D-HEXOSE-6-PHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) | ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 258.121 | ** 258.121 | ||
+ | * inchi key: | ||
+ | ** InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L | ||
+ | * common name: | ||
+ | ** D-hexose 6-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[HEXOKINASE-RXN]] | * [[HEXOKINASE-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61567 61567] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61567 61567] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4459709 4459709] | ||
+ | * REFMET : Hexose-6-phosphate | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C02965 C02965] | ** [http://www.genome.jp/dbget-bin/www_bget?C02965 C02965] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.3658466.html 3658466] | ||
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} | ||
− | |||
− | |||
{{#set: molecular weight=258.121 }} | {{#set: molecular weight=258.121 }} | ||
− | {{#set: | + | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L}} |
+ | {{#set: common name=D-hexose 6-phosphate}} | ||
+ | {{#set: produced by=HEXOKINASE-RXN}} |
Latest revision as of 15:04, 10 January 2019
Contents
Metabolite D-HEXOSE-6-PHOSPHATE
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
- molecular weight:
- 258.121
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L
- common name:
- D-hexose 6-phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.