Difference between revisions of "BETA-L-ARABINOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-L-ARABINOSE BETA-L-ARABINOSE] == * smiles: ** C1(C(C(C(C(O1)O)O)O)O) * common name: ** &be...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C(C(C(C(O1)O)O)O)O) | ** C1(C(C(C(C(O1)O)O)O)O) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 150.131 | ** 150.131 | ||
+ | * inchi key: | ||
+ | ** InChIKey=SRBFZHDQGSBBOR-KLVWXMOXSA-N | ||
+ | * common name: | ||
+ | ** β-L-arabinopyranose | ||
* Synonym(s): | * Synonym(s): | ||
** β-L-arabinose | ** β-L-arabinose | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=40886 40886] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=40886 40886] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439764 439764] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439764 439764] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02479 C02479] | ||
{{#set: smiles=C1(C(C(C(C(O1)O)O)O)O)}} | {{#set: smiles=C1(C(C(C(C(O1)O)O)O)O)}} | ||
− | |||
− | |||
{{#set: molecular weight=150.131 }} | {{#set: molecular weight=150.131 }} | ||
+ | {{#set: inchi key=InChIKey=SRBFZHDQGSBBOR-KLVWXMOXSA-N}} | ||
+ | {{#set: common name=β-L-arabinopyranose}} | ||
{{#set: common name=β-L-arabinose}} | {{#set: common name=β-L-arabinose}} | ||
{{#set: produced by=BETA-L-ARABINOSIDASE-RXN}} | {{#set: produced by=BETA-L-ARABINOSIDASE-RXN}} |
Latest revision as of 15:13, 10 January 2019
Contents
Metabolite BETA-L-ARABINOSE
- smiles:
- C1(C(C(C(C(O1)O)O)O)O)
- molecular weight:
- 150.131
- inchi key:
- InChIKey=SRBFZHDQGSBBOR-KLVWXMOXSA-N
- common name:
- β-L-arabinopyranose
- Synonym(s):
- β-L-arabinose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links