Difference between revisions of "GLUCOSAMINE-1P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINE-1P GLUCOSAMINE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C([N+])C(O)C(O)1) * c...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(OC(OP(=O)([O-])[O-])C([N+])C(O)C(O)1) | ** C(O)C1(OC(OP(=O)([O-])[O-])C([N+])C(O)C(O)1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 258.144 | ** 258.144 | ||
| + | * inchi key: | ||
| + | ** InChIKey=YMJBYRVFGYXULK-QZABAPFNSA-M | ||
| + | * common name: | ||
| + | ** D-glucosamine 1-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** glucosamine-1P | ** glucosamine-1P | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58516 58516] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58516 58516] | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243931 25243931] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243931 25243931] | ||
| + | * HMDB : HMDB01109 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06156 C06156] | ||
| + | * BIGG : gam1p | ||
{{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C([N+])C(O)C(O)1)}} | {{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C([N+])C(O)C(O)1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=258.144 }} | {{#set: molecular weight=258.144 }} | ||
| + | {{#set: inchi key=InChIKey=YMJBYRVFGYXULK-QZABAPFNSA-M}} | ||
| + | {{#set: common name=D-glucosamine 1-phosphate}} | ||
{{#set: common name=glucosamine-1P|α-D-glucosamine 1P|α-D-glucosamine 1-phosphate}} | {{#set: common name=glucosamine-1P|α-D-glucosamine 1P|α-D-glucosamine 1-phosphate}} | ||
{{#set: consumed by=2.3.1.157-RXN}} | {{#set: consumed by=2.3.1.157-RXN}} | ||
Latest revision as of 14:23, 10 January 2019
Contents
Metabolite GLUCOSAMINE-1P
- smiles:
- C(O)C1(OC(OP(=O)([O-])[O-])C([N+])C(O)C(O)1)
- molecular weight:
- 258.144
- inchi key:
- InChIKey=YMJBYRVFGYXULK-QZABAPFNSA-M
- common name:
- D-glucosamine 1-phosphate
- Synonym(s):
- glucosamine-1P
- α-D-glucosamine 1P
- α-D-glucosamine 1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(OC(OP(=O)([O-])[O-])C([N+])C(O)C(O)1)" cannot be used as a page name in this wiki.
