Difference between revisions of "GLC-D-LACTONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * common name: ** D-gluc...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(OC(C(C(C1O)O)O)=O) | ** C(O)C1(OC(C(C(C1O)O)O)=O) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 178.141 | ** 178.141 | ||
+ | * inchi key: | ||
+ | ** InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N | ||
+ | * common name: | ||
+ | ** D-glucono-1,5-lactone | ||
* Synonym(s): | * Synonym(s): | ||
** 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one | ** 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one | ||
Line 23: | Line 23: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
* [[GLUCONOLACT-RXN]] | * [[GLUCONOLACT-RXN]] | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.6760.html 6760] | ** [http://www.chemspider.com/Chemical-Structure.6760.html 6760] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7027 7027] | ||
+ | * DRUGBANK : DB04564 | ||
+ | * REFMET : Gluconolactone | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16217 16217] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16217 16217] | ||
+ | * CAS : 90-80-2 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00198 C00198] | ||
+ | * HMDB : HMDB00150 | ||
{{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}} | {{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}} | ||
− | |||
− | |||
{{#set: molecular weight=178.141 }} | {{#set: molecular weight=178.141 }} | ||
+ | {{#set: inchi key=InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N}} | ||
+ | {{#set: common name=D-glucono-1,5-lactone}} | ||
{{#set: common name=3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one|gluconolactone|glucono-1,5-lactone|1,5-gluconolactone|D-gluconolactone|glucono-δ-lactone|δ-gluconolactone|D-glucono-δ-lactone|gluconic lactone|gluconic acid lactone}} | {{#set: common name=3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one|gluconolactone|glucono-1,5-lactone|1,5-gluconolactone|D-gluconolactone|glucono-δ-lactone|δ-gluconolactone|D-glucono-δ-lactone|gluconic lactone|gluconic acid lactone}} | ||
− | {{#set: consumed by=GLUCONOLACT-RXN | + | {{#set: consumed by=GLUCONOLACT-RXN}} |
− | + |
Latest revision as of 15:33, 10 January 2019
Contents
Metabolite GLC-D-LACTONE
- smiles:
- C(O)C1(OC(C(C(C1O)O)O)=O)
- molecular weight:
- 178.141
- inchi key:
- InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N
- common name:
- D-glucono-1,5-lactone
- Synonym(s):
- 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one
- gluconolactone
- glucono-1,5-lactone
- 1,5-gluconolactone
- D-gluconolactone
- glucono-δ-lactone
- δ-gluconolactone
- D-glucono-δ-lactone
- gluconic lactone
- gluconic acid lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEMSPIDER:
- PUBCHEM:
- DRUGBANK : DB04564
- REFMET : Gluconolactone
- CHEBI:
- CAS : 90-80-2
- LIGAND-CPD:
- HMDB : HMDB00150