Difference between revisions of "CPD-731"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == * smiles: ** CCC=CCC1(C(=O)CCC1CC([O-])=O) * common name: ** (+)-7-iso-jasm...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC=CCC1(C(=O)CCC1CC([O-])=O) | ** CCC=CCC1(C(=O)CCC1CC([O-])=O) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 209.264 | ** 209.264 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M | ||
+ | * common name: | ||
+ | ** (+)-7-epi-jasmonate | ||
* Synonym(s): | * Synonym(s): | ||
** (+)-7-iso-jasmonic acid | ** (+)-7-iso-jasmonic acid | ||
** iso-jasmonic acid | ** iso-jasmonic acid | ||
** (3R,7S)-(+)-7-iso-jasmonate | ** (3R,7S)-(+)-7-iso-jasmonate | ||
+ | ** (+)-7-iso-jasmonate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
Line 19: | Line 20: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=136179 136179] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7251182 7251182] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7251182 7251182] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.5584838.html 5584838] | ** [http://www.chemspider.com/Chemical-Structure.5584838.html 5584838] | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16317 C16317] | ** [http://www.genome.jp/dbget-bin/www_bget?C16317 C16317] | ||
+ | * LIPID_MAPS : LMFA02020003 | ||
{{#set: smiles=CCC=CCC1(C(=O)CCC1CC([O-])=O)}} | {{#set: smiles=CCC=CCC1(C(=O)CCC1CC([O-])=O)}} | ||
− | |||
− | |||
{{#set: molecular weight=209.264 }} | {{#set: molecular weight=209.264 }} | ||
− | {{#set: common name=(+)-7-iso-jasmonic acid|iso-jasmonic acid|(3R,7S)-(+)-7-iso-jasmonate}} | + | {{#set: inchi key=InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M}} |
+ | {{#set: common name=(+)-7-epi-jasmonate}} | ||
+ | {{#set: common name=(+)-7-iso-jasmonic acid|iso-jasmonic acid|(3R,7S)-(+)-7-iso-jasmonate|(+)-7-iso-jasmonate}} | ||
{{#set: produced by=RXN-10708}} | {{#set: produced by=RXN-10708}} |
Latest revision as of 15:37, 10 January 2019
Contents
Metabolite CPD-731
- smiles:
- CCC=CCC1(C(=O)CCC1CC([O-])=O)
- molecular weight:
- 209.264
- inchi key:
- InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M
- common name:
- (+)-7-epi-jasmonate
- Synonym(s):
- (+)-7-iso-jasmonic acid
- iso-jasmonic acid
- (3R,7S)-(+)-7-iso-jasmonate
- (+)-7-iso-jasmonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC1(C(=O)CCC1CC([O-])=O)" cannot be used as a page name in this wiki.