Difference between revisions of "DMPBQ"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C * common na...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 416.686 | ** 416.686 | ||
+ | * inchi key: | ||
+ | ** InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N | ||
+ | * common name: | ||
+ | ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-2542]] | * [[RXN-2542]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * METABOLIGHTS : MTBLC75921 |
− | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75921 75921] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75921 75921] | ||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C15883 C15883] | ** [http://www.genome.jp/dbget-bin/www_bget?C15883 C15883] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768102 71768102] | ||
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C}} | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C}} | ||
− | |||
− | |||
{{#set: molecular weight=416.686 }} | {{#set: molecular weight=416.686 }} | ||
− | {{#set: | + | {{#set: inchi key=InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N}} |
+ | {{#set: common name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}} | ||
{{#set: produced by=RXN-2542}} | {{#set: produced by=RXN-2542}} |
Latest revision as of 15:40, 10 January 2019
Contents
Metabolite DMPBQ
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C
- molecular weight:
- 416.686
- inchi key:
- InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N
- common name:
- 2,3-dimethyl-6-phytyl-1,4-benzoquinol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links