Difference between revisions of "ITP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) | ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 504.137 | ** 504.137 | ||
| + | * inchi key: | ||
| + | ** InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J | ||
| + | * common name: | ||
| + | ** ITP | ||
* Synonym(s): | * Synonym(s): | ||
** inosine triphosphate | ** inosine triphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
* [[ITUP]] | * [[ITUP]] | ||
| + | * [[ITPP]] | ||
| + | * [[RXN0-5073]] | ||
* [[RXN0-6382]] | * [[RXN0-6382]] | ||
* [[ITCY]] | * [[ITCY]] | ||
| Line 22: | Line 22: | ||
* [[ATID]] | * [[ATID]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
* [[ATP-DEAMINASE-RXN]] | * [[ATP-DEAMINASE-RXN]] | ||
| + | * [[RXN-14120]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796439 25796439] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796439 25796439] | ||
| − | * | + | * REFMET : ITP |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61402 61402] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61402 61402] | ||
| + | * CAS : 132-06-9 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00081 C00081] | ||
| + | * HMDB : HMDB00189 | ||
* BIGG : itp | * BIGG : itp | ||
{{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | {{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=504.137 }} | {{#set: molecular weight=504.137 }} | ||
| + | {{#set: inchi key=InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J}} | ||
| + | {{#set: common name=ITP}} | ||
{{#set: common name=inosine triphosphate}} | {{#set: common name=inosine triphosphate}} | ||
| − | {{#set: consumed by= | + | {{#set: consumed by=ITUP|ITPP|RXN0-5073|RXN0-6382|ITCY}} |
{{#set: produced by=ATIDm|ATID}} | {{#set: produced by=ATIDm|ATID}} | ||
| − | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=ATP-DEAMINASE-RXN|RXN-14120}} |
Latest revision as of 14:41, 10 January 2019
Contents
Metabolite ITP
- smiles:
- C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- molecular weight:
- 504.137
- inchi key:
- InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J
- common name:
- ITP
- Synonym(s):
- inosine triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- REFMET : ITP
- CHEBI:
- CAS : 132-06-9
- LIGAND-CPD:
- HMDB : HMDB00189
- BIGG : itp
"C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.
