Difference between revisions of "O-UREIDOHOMOSERINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * common na...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(CC(C(=O)[O-])[N+])ONC(N)=O | ** C(CC(C(=O)[O-])[N+])ONC(N)=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 177.16 | ** 177.16 | ||
+ | * inchi key: | ||
+ | ** InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N | ||
+ | * common name: | ||
+ | ** O-ureido-L-homoserine | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** O-(carbamoylamino)-L-homoserine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
Line 21: | Line 22: | ||
* HMDB : HMDB12271 | * HMDB : HMDB12271 | ||
{{#set: smiles=C(CC(C(=O)[O-])[N+])ONC(N)=O}} | {{#set: smiles=C(CC(C(=O)[O-])[N+])ONC(N)=O}} | ||
− | |||
− | |||
{{#set: molecular weight=177.16 }} | {{#set: molecular weight=177.16 }} | ||
+ | {{#set: inchi key=InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N}} | ||
+ | {{#set: common name=O-ureido-L-homoserine}} | ||
+ | {{#set: common name=O-(carbamoylamino)-L-homoserine}} | ||
{{#set: consumed by=RXN-10}} | {{#set: consumed by=RXN-10}} | ||
{{#set: produced by=RXN-9}} | {{#set: produced by=RXN-9}} |
Latest revision as of 15:41, 10 January 2019
Contents
Metabolite O-UREIDOHOMOSERINE
- smiles:
- C(CC(C(=O)[O-])[N+])ONC(N)=O
- molecular weight:
- 177.16
- inchi key:
- InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N
- common name:
- O-ureido-L-homoserine
- Synonym(s):
- O-(carbamoylamino)-L-homoserine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12271
"C(CC(C(=O)[O-])[N+])ONC(N)=O" cannot be used as a page name in this wiki.