Difference between revisions of "CPD-11403"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2)) *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2)) | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 746.825 | ** 746.825 | ||
| + | * inchi key: | ||
| + | ** InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** tetraiodothyroacetate | ||
* Synonym(s): | * Synonym(s): | ||
** Tetrac | ** Tetrac | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-10617]] | * [[RXN-10617]] | ||
| + | * [[RXN-10616]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| Line 23: | Line 23: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237272 44237272] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237272 44237272] | ||
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))}} | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=746.825 }} | {{#set: molecular weight=746.825 }} | ||
| + | {{#set: inchi key=InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=tetraiodothyroacetate}} | ||
{{#set: common name=Tetrac|tetraiodothyroacetic acid|TA4}} | {{#set: common name=Tetrac|tetraiodothyroacetic acid|TA4}} | ||
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-10617|RXN-10616}} |
Latest revision as of 14:43, 10 January 2019
Contents
Metabolite CPD-11403
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))
- molecular weight:
- 746.825
- inchi key:
- InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M
- common name:
- tetraiodothyroacetate
- Synonym(s):
- Tetrac
- tetraiodothyroacetic acid
- TA4
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))" cannot be used as a page name in this wiki.
