Difference between revisions of "CPD-330"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) * common name: ** L-galactono-1...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) | ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 178.141 | ** 178.141 | ||
+ | * inchi key: | ||
+ | ** InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N | ||
+ | * common name: | ||
+ | ** L-galactono-1,4-lactone | ||
* Synonym(s): | * Synonym(s): | ||
** L-galactono-γ-lactone | ** L-galactono-γ-lactone | ||
Line 22: | Line 22: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.388522.html 388522] | ** [http://www.chemspider.com/Chemical-Structure.388522.html 388522] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17464 17464] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17464 17464] | ||
+ | * CAS : 1668-08-2 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01115 C01115] | ** [http://www.genome.jp/dbget-bin/www_bget?C01115 C01115] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857365 6857365] | ||
{{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}} | {{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}} | ||
− | |||
− | |||
{{#set: molecular weight=178.141 }} | {{#set: molecular weight=178.141 }} | ||
+ | {{#set: inchi key=InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N}} | ||
+ | {{#set: common name=L-galactono-1,4-lactone}} | ||
{{#set: common name=L-galactono-γ-lactone|L-galactonate-γ-lactone|L-galactonic acid-γ-lactone|L-galactonic acid-g-lactone}} | {{#set: common name=L-galactono-γ-lactone|L-galactonate-γ-lactone|L-galactonic acid-γ-lactone|L-galactonic acid-g-lactone}} | ||
{{#set: consumed by=RXN-11153|1.3.3.12-RXN}} | {{#set: consumed by=RXN-11153|1.3.3.12-RXN}} | ||
{{#set: produced by=RXN-1884}} | {{#set: produced by=RXN-1884}} |
Latest revision as of 14:44, 10 January 2019
Contents
Metabolite CPD-330
- smiles:
- C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
- molecular weight:
- 178.141
- inchi key:
- InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N
- common name:
- L-galactono-1,4-lactone
- Synonym(s):
- L-galactono-γ-lactone
- L-galactonate-γ-lactone
- L-galactonic acid-γ-lactone
- L-galactonic acid-g-lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)" cannot be used as a page name in this wiki.