Difference between revisions of "CPD-9958"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9958 CPD-9958] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1) | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 865.373 | ** 865.373 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QNTNKSLOFHEFPK-UPTCCGCDSA-N | ||
| + | * common name: | ||
| + | ** ubiquinol-10 | ||
* Synonym(s): | * Synonym(s): | ||
** ubiquinol(10) | ** ubiquinol(10) | ||
| Line 16: | Line 16: | ||
* [[RXN-9237]] | * [[RXN-9237]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC64183 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9962735 9962735] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9962735 9962735] | ||
| − | * | + | * HMDB : HMDB13111 |
| − | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64183 64183] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64183 64183] | ||
| − | * | + | * CHEMSPIDER: |
| − | * | + | ** [http://www.chemspider.com/Chemical-Structure.8138335.html 8138335] |
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}} | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=865.373 }} | {{#set: molecular weight=865.373 }} | ||
| + | {{#set: inchi key=InChIKey=QNTNKSLOFHEFPK-UPTCCGCDSA-N}} | ||
| + | {{#set: common name=ubiquinol-10}} | ||
{{#set: common name=ubiquinol(10)}} | {{#set: common name=ubiquinol(10)}} | ||
{{#set: produced by=RXN-9237}} | {{#set: produced by=RXN-9237}} | ||
| − | |||
Latest revision as of 14:49, 10 January 2019
Contents
Metabolite CPD-9958
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
- molecular weight:
- 865.373
- inchi key:
- InChIKey=QNTNKSLOFHEFPK-UPTCCGCDSA-N
- common name:
- ubiquinol-10
- Synonym(s):
- ubiquinol(10)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
