Difference between revisions of "CPD-1301"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] == * smiles: ** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CC...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3) | ** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 699.633 | ** 699.633 | ||
+ | * inchi key: | ||
+ | ** InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J | ||
+ | * common name: | ||
+ | ** tetrahydropteroyl tri-L-glutamate | ||
* Synonym(s): | * Synonym(s): | ||
** H4PteGlu3 | ** H4PteGlu3 | ||
Line 18: | Line 18: | ||
* [[HOMOCYSMET-RXN]] | * [[HOMOCYSMET-RXN]] | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58140 58140] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791999 49791999] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791999 49791999] | ||
− | |||
− | |||
* HMDB : HMDB12290 | * HMDB : HMDB12290 | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04144 C04144] | ** [http://www.genome.jp/dbget-bin/www_bget?C04144 C04144] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.17625690.html 17625690] | ||
{{#set: smiles=C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)}} | {{#set: smiles=C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)}} | ||
− | |||
− | |||
{{#set: molecular weight=699.633 }} | {{#set: molecular weight=699.633 }} | ||
+ | {{#set: inchi key=InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J}} | ||
+ | {{#set: common name=tetrahydropteroyl tri-L-glutamate}} | ||
{{#set: common name=H4PteGlu3}} | {{#set: common name=H4PteGlu3}} | ||
{{#set: produced by=RXN-12730}} | {{#set: produced by=RXN-12730}} | ||
{{#set: reversible reaction associated=HOMOCYSMET-RXN}} | {{#set: reversible reaction associated=HOMOCYSMET-RXN}} |
Latest revision as of 10:43, 10 January 2019
Contents
Metabolite CPD-1301
- smiles:
- C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)
- molecular weight:
- 699.633
- inchi key:
- InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J
- common name:
- tetrahydropteroyl tri-L-glutamate
- Synonym(s):
- H4PteGlu3
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)" cannot be used as a page name in this wiki.