Difference between revisions of "CPD-14053"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14053 CPD-14053] == * smiles: ** CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O)) * common name: *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O)) | ** CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 241.249 | ** 241.249 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FNKQXYHWGSIFBK-RPDRRWSUSA-N | ||
| + | * common name: | ||
| + | ** (6R)-L-erythro-5,6,7,8-tetrahydrobiopterin | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** sapropterin |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC59560 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44257 44257] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44257 44257] | ||
| + | * HMDB : HMDB00787 | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59560 59560] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59560 59560] | ||
| − | |||
| − | |||
{{#set: smiles=CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O))}} | {{#set: smiles=CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=241.249 }} | {{#set: molecular weight=241.249 }} | ||
| − | {{#set: common name=(6R)-5,6,7,8-tetrahydrobiopterin}} | + | {{#set: inchi key=InChIKey=FNKQXYHWGSIFBK-RPDRRWSUSA-N}} |
| + | {{#set: common name=(6R)-L-erythro-5,6,7,8-tetrahydrobiopterin}} | ||
| + | {{#set: common name=sapropterin}} | ||
{{#set: produced by=RXN-8853}} | {{#set: produced by=RXN-8853}} | ||
Latest revision as of 10:49, 10 January 2019
Contents
Metabolite CPD-14053
- smiles:
- CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O))
- molecular weight:
- 241.249
- inchi key:
- InChIKey=FNKQXYHWGSIFBK-RPDRRWSUSA-N
- common name:
- (6R)-L-erythro-5,6,7,8-tetrahydrobiopterin
- Synonym(s):
- sapropterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O))" cannot be used as a page name in this wiki.
