Difference between revisions of "CPD1F-131"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C...") |
|||
Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] == | ||
* smiles: | * smiles: | ||
− | ** CC(=CC=CC=C(C=CC=C(C=CC12(C( | + | ** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC3(C(C)(C)CC(O)CC(C)=3) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* molecular weight: | * molecular weight: | ||
** 584.881 | ** 584.881 | ||
+ | * inchi key: | ||
+ | ** InChIKey=OFNSUWBAQRCHAV-OYQUVCAXSA-N | ||
+ | * common name: | ||
+ | ** antheraxanthin | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
* [[ANXANOR]] | * [[ANXANOR]] | ||
+ | * [[RXN-7985]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-7984]] | * [[RXN-7984]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27867 27867] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27867 27867] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244322 25244322] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C08579 C08579] | ** [http://www.genome.jp/dbget-bin/www_bget?C08579 C08579] | ||
− | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC12(C( | + | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC3(C(C)(C)CC(O)CC(C)=3)}} |
− | + | ||
− | + | ||
{{#set: molecular weight=584.881 }} | {{#set: molecular weight=584.881 }} | ||
− | {{#set: consumed by=RXN-7985 | + | {{#set: inchi key=InChIKey=OFNSUWBAQRCHAV-OYQUVCAXSA-N}} |
+ | {{#set: common name=antheraxanthin}} | ||
+ | {{#set: consumed by=ANXANOR|RXN-7985}} | ||
{{#set: produced by=RXN-7984}} | {{#set: produced by=RXN-7984}} |
Latest revision as of 11:53, 10 January 2019
Contents
Metabolite CPD1F-131
- smiles:
- CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC3(C(C)(C)CC(O)CC(C)=3)
- molecular weight:
- 584.881
- inchi key:
- InChIKey=OFNSUWBAQRCHAV-OYQUVCAXSA-N
- common name:
- antheraxanthin
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links