Difference between revisions of "CPD-4125"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 412.698 | ** 412.698 | ||
| + | * inchi key: | ||
| + | ** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N | ||
| + | * common name: | ||
| + | ** avenasterol | ||
* Synonym(s): | * Synonym(s): | ||
| Line 23: | Line 23: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782] | ** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782] | ||
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | {{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=412.698 }} | {{#set: molecular weight=412.698 }} | ||
| + | {{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}} | ||
| + | {{#set: common name=avenasterol}} | ||
{{#set: consumed by=RXN-4209}} | {{#set: consumed by=RXN-4209}} | ||
{{#set: reversible reaction associated=RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.}} | {{#set: reversible reaction associated=RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.}} | ||
Latest revision as of 10:57, 10 January 2019
Contents
Metabolite CPD-4125
- smiles:
- CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 412.698
- inchi key:
- InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
- common name:
- avenasterol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
