Difference between revisions of "BILIVERDINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == | ||
* smiles: | * smiles: | ||
| − | ** C=CC1( | + | ** C=CC1(C(NC(C(C)=1)=O)=CC4(=C(C)C(=C(C=C3(N=C(C=C2(C(C)=C(C=C)C(N2)=O))C(C)=C3CCC([O-])=O))N4)CCC([O-])=O)) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
** 580.639 | ** 580.639 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QBUVFDKTZJNUPP-MSGWKZGBSA-L | ||
| + | * common name: | ||
| + | ** biliverdin-IX-α | ||
* Synonym(s): | * Synonym(s): | ||
** dehydrobilirubin | ** dehydrobilirubin | ||
| Line 14: | Line 14: | ||
** biliverdine | ** biliverdine | ||
** biliverdin | ** biliverdin | ||
| + | ** 8,12-bis(2-carboxyethyl)-2,7,13,17-tetramethyl-3,18-divinylbilin-1(19)(21H,24H)-dione | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
* [[1.3.7.2-RXN]] | * [[1.3.7.2-RXN]] | ||
* [[1.3.7.4-RXN]] | * [[1.3.7.4-RXN]] | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[HEME-OXYGENASE-DECYCLIZING-RXN]] | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] | ||
| Line 25: | Line 25: | ||
* [[R05818]] | * [[R05818]] | ||
== External links == | == External links == | ||
| − | * | + | * METABOLIGHTS : MTBLC57991 |
| − | ** [http:// | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=126961208 126961208] | ||
* HMDB : HMDB01008 | * HMDB : HMDB01008 | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57991 57991] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57991 57991] | ||
| − | * | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00500 C00500] | |
| − | ** [http:// | + | {{#set: smiles=C=CC1(C(NC(C(C)=1)=O)=CC4(=C(C)C(=C(C=C3(N=C(C=C2(C(C)=C(C=C)C(N2)=O))C(C)=C3CCC([O-])=O))N4)CCC([O-])=O))}} |
| − | {{#set: smiles=C=CC1( | + | |
| − | + | ||
| − | + | ||
{{#set: molecular weight=580.639 }} | {{#set: molecular weight=580.639 }} | ||
| − | {{#set: common name=dehydrobilirubin|uteroverdine|biliverdine|biliverdin}} | + | {{#set: inchi key=InChIKey=QBUVFDKTZJNUPP-MSGWKZGBSA-L}} |
| − | {{#set: consumed by=1.3.7.2-RXN|1.3.7.4 | + | {{#set: common name=biliverdin-IX-α}} |
| + | {{#set: common name=dehydrobilirubin|uteroverdine|biliverdine|biliverdin|8,12-bis(2-carboxyethyl)-2,7,13,17-tetramethyl-3,18-divinylbilin-1(19)(21H,24H)-dione}} | ||
| + | {{#set: consumed by=1.3.7.2-RXN|1.3.7.4-RXN}} | ||
{{#set: produced by=HEME-OXYGENASE-DECYCLIZING-RXN|RXN-17523}} | {{#set: produced by=HEME-OXYGENASE-DECYCLIZING-RXN|RXN-17523}} | ||
{{#set: reversible reaction associated=R05818}} | {{#set: reversible reaction associated=R05818}} | ||
Latest revision as of 12:09, 10 January 2019
Contents
Metabolite BILIVERDINE
- smiles:
- C=CC1(C(NC(C(C)=1)=O)=CC4(=C(C)C(=C(C=C3(N=C(C=C2(C(C)=C(C=C)C(N2)=O))C(C)=C3CCC([O-])=O))N4)CCC([O-])=O))
- molecular weight:
- 580.639
- inchi key:
- InChIKey=QBUVFDKTZJNUPP-MSGWKZGBSA-L
- common name:
- biliverdin-IX-α
- Synonym(s):
- dehydrobilirubin
- uteroverdine
- biliverdine
- biliverdin
- 8,12-bis(2-carboxyethyl)-2,7,13,17-tetramethyl-3,18-divinylbilin-1(19)(21H,24H)-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC1(C(NC(C(C)=1)=O)=CC4(=C(C)C(=C(C=C3(N=C(C=C2(C(C)=C(C=C)C(N2)=O))C(C)=C3CCC([O-])=O))N4)CCC([O-])=O))" cannot be used as a page name in this wiki.
