Difference between revisions of "CPD1F-133"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] == * smiles: ** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4) | ** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 600.88 | ** 600.88 | ||
+ | * inchi key: | ||
+ | ** InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N | ||
+ | * common name: | ||
+ | ** violaxanthin | ||
* Synonym(s): | * Synonym(s): | ||
** 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol | ** 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol | ||
Line 20: | Line 20: | ||
* [[RXN-13185]] | * [[RXN-13185]] | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35288 35288] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448438 448438] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448438 448438] | ||
* HMDB : HMDB03101 | * HMDB : HMDB03101 | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C08614 C08614] | ** [http://www.genome.jp/dbget-bin/www_bget?C08614 C08614] | ||
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}} | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}} | ||
− | |||
− | |||
{{#set: molecular weight=600.88 }} | {{#set: molecular weight=600.88 }} | ||
+ | {{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N}} | ||
+ | {{#set: common name=violaxanthin}} | ||
{{#set: common name=5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol}} | {{#set: common name=5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol}} | ||
{{#set: consumed by=RXN1F-155|RXN-7984}} | {{#set: consumed by=RXN1F-155|RXN-7984}} | ||
{{#set: produced by=ANXANOR}} | {{#set: produced by=ANXANOR}} | ||
{{#set: reversible reaction associated=RXN-13185}} | {{#set: reversible reaction associated=RXN-13185}} |
Latest revision as of 12:20, 10 January 2019
Contents
Metabolite CPD1F-133
- smiles:
- CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
- molecular weight:
- 600.88
- inchi key:
- InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N
- common name:
- violaxanthin
- Synonym(s):
- 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links