Difference between revisions of "CPD-11647"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11647 CPD-11647] == * smiles: ** C([N+])CCC[N+]CCC[N+]CCC[N+] * common name: ** thermosperm...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([N+])CCC[N+]CCC[N+]CCC[N+] | ** C([N+])CCC[N+]CCC[N+]CCC[N+] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 206.374 | ** 206.374 | ||
+ | * inchi key: | ||
+ | ** InChIKey=DODDBCGMRAFLEB-UHFFFAOYSA-R | ||
+ | * common name: | ||
+ | ** thermospermine | ||
* Synonym(s): | * Synonym(s): | ||
** 1,12-diamino-4,8-diazadodecane | ** 1,12-diamino-4,8-diazadodecane | ||
Line 18: | Line 18: | ||
* [[RXN-11190]] | * [[RXN-11190]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.10446529.html 10446529] | ** [http://www.chemspider.com/Chemical-Structure.10446529.html 10446529] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59903 59903] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59903 59903] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23278624 23278624] | ||
{{#set: smiles=C([N+])CCC[N+]CCC[N+]CCC[N+]}} | {{#set: smiles=C([N+])CCC[N+]CCC[N+]CCC[N+]}} | ||
− | |||
− | |||
{{#set: molecular weight=206.374 }} | {{#set: molecular weight=206.374 }} | ||
+ | {{#set: inchi key=InChIKey=DODDBCGMRAFLEB-UHFFFAOYSA-R}} | ||
+ | {{#set: common name=thermospermine}} | ||
{{#set: common name=1,12-diamino-4,8-diazadodecane|N1-(3-(3-aminopropylamino)propyl)butane-1,4-diamine}} | {{#set: common name=1,12-diamino-4,8-diazadodecane|N1-(3-(3-aminopropylamino)propyl)butane-1,4-diamine}} | ||
{{#set: reversible reaction associated=RXN-11190}} | {{#set: reversible reaction associated=RXN-11190}} |
Latest revision as of 12:21, 10 January 2019
Contents
Metabolite CPD-11647
- smiles:
- C([N+])CCC[N+]CCC[N+]CCC[N+]
- molecular weight:
- 206.374
- inchi key:
- InChIKey=DODDBCGMRAFLEB-UHFFFAOYSA-R
- common name:
- thermospermine
- Synonym(s):
- 1,12-diamino-4,8-diazadodecane
- N1-(3-(3-aminopropylamino)propyl)butane-1,4-diamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])CCC[N+]CCC[N+]CCC[N+" cannot be used as a page name in this wiki.