Difference between revisions of "CPD-14795"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14795 CPD-14795] == * smiles: ** CC(NC3(C(OP(OP(OCC1(C(C(C(O1)N2(C=CC(NC2=O)=O))O)O))([O-])...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(NC3(C(OP(OP(OCC1(C(C(C(O1)N2(C=CC(NC2=O)=O))O)O))([O-])=O)([O-])=O)OC(C(C3O)O)CO))=O | ** CC(NC3(C(OP(OP(OCC1(C(C(C(O1)N2(C=CC(NC2=O)=O))O)O))([O-])=O)([O-])=O)OC(C(C3O)O)CO))=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 605.342 | ** 605.342 | ||
+ | * inchi key: | ||
+ | ** InChIKey=LFTYTUAZOPRMMI-NESSUJCYSA-L | ||
+ | * common name: | ||
+ | ** UDP-N-acetyl-α-D-galactosamine | ||
* Synonym(s): | * Synonym(s): | ||
** UDP-GalNAc | ** UDP-GalNAc | ||
Line 15: | Line 15: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]] | ||
* [[RXN-14841]] | * [[RXN-14841]] | ||
* [[RXN-13760]] | * [[RXN-13760]] | ||
− | |||
== External links == | == External links == | ||
− | * | + | * METABOLIGHTS : MTBLC67138 |
− | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67138 67138] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67138 67138] | ||
− | * | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244913 25244913] | ||
{{#set: smiles=CC(NC3(C(OP(OP(OCC1(C(C(C(O1)N2(C=CC(NC2=O)=O))O)O))([O-])=O)([O-])=O)OC(C(C3O)O)CO))=O}} | {{#set: smiles=CC(NC3(C(OP(OP(OCC1(C(C(C(O1)N2(C=CC(NC2=O)=O))O)O))([O-])=O)([O-])=O)OC(C(C3O)O)CO))=O}} | ||
− | |||
− | |||
{{#set: molecular weight=605.342 }} | {{#set: molecular weight=605.342 }} | ||
+ | {{#set: inchi key=InChIKey=LFTYTUAZOPRMMI-NESSUJCYSA-L}} | ||
+ | {{#set: common name=UDP-N-acetyl-α-D-galactosamine}} | ||
{{#set: common name=UDP-GalNAc}} | {{#set: common name=UDP-GalNAc}} | ||
− | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN|RXN-14841|RXN-13760}} |
Latest revision as of 12:31, 10 January 2019
Contents
Metabolite CPD-14795
- smiles:
- CC(NC3(C(OP(OP(OCC1(C(C(C(O1)N2(C=CC(NC2=O)=O))O)O))([O-])=O)([O-])=O)OC(C(C3O)O)CO))=O
- molecular weight:
- 605.342
- inchi key:
- InChIKey=LFTYTUAZOPRMMI-NESSUJCYSA-L
- common name:
- UDP-N-acetyl-α-D-galactosamine
- Synonym(s):
- UDP-GalNAc
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(NC3(C(OP(OP(OCC1(C(C(C(O1)N2(C=CC(NC2=O)=O))O)O))([O-])=O)([O-])=O)OC(C(C3O)O)CO))=O" cannot be used as a page name in this wiki.