Difference between revisions of "CPD-12706"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12706 CPD-12706] == * smiles: ** C(C1(OC(OP([O-])(=O)[O-])C(O)C1O))F * common name: ** 5-fl...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(OC(OP([O-])(=O)[O-])C(O)C1O))F | ** C(C1(OC(OP([O-])(=O)[O-])C(O)C1O))F | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 230.086 | ** 230.086 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LUQFMENCTWEBSQ-TXICZTDVSA-L | ||
| + | * common name: | ||
| + | ** 5-fluoro-5-deoxy-D-ribose 1-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
| Line 19: | Line 19: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859615 49859615] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859615 49859615] | ||
{{#set: smiles=C(C1(OC(OP([O-])(=O)[O-])C(O)C1O))F}} | {{#set: smiles=C(C1(OC(OP([O-])(=O)[O-])C(O)C1O))F}} | ||
| − | |||
| − | |||
{{#set: molecular weight=230.086 }} | {{#set: molecular weight=230.086 }} | ||
| + | {{#set: inchi key=InChIKey=LUQFMENCTWEBSQ-TXICZTDVSA-L}} | ||
| + | {{#set: common name=5-fluoro-5-deoxy-D-ribose 1-phosphate}} | ||
{{#set: produced by=RXN-11743}} | {{#set: produced by=RXN-11743}} | ||
Latest revision as of 11:35, 10 January 2019
Contents
Metabolite CPD-12706
- smiles:
- C(C1(OC(OP([O-])(=O)[O-])C(O)C1O))F
- molecular weight:
- 230.086
- inchi key:
- InChIKey=LUQFMENCTWEBSQ-TXICZTDVSA-L
- common name:
- 5-fluoro-5-deoxy-D-ribose 1-phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C1(OC(OP([O-])(=O)[O-])C(O)C1O))F" cannot be used as a page name in this wiki.
