Difference between revisions of "CPD-10792"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10792 CPD-10792] == * smiles: ** CC(=O)C(O)C(O)CC([N+])C([O-])=O * common name: ** 2-amino-...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=O)C(O)C(O)CC([N+])C([O-])=O | ** CC(=O)C(O)C(O)CC([N+])C([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 191.183 | ** 191.183 | ||
| + | * inchi key: | ||
| + | ** InChIKey=IFMHGOADXGYWMO-KVQBGUIXSA-N | ||
| + | * common name: | ||
| + | ** 2-amino-3,7-dideoxy-D-threo-hept-6-ulosonate | ||
* Synonym(s): | * Synonym(s): | ||
** ADTH | ** ADTH | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58859 58859] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58859 58859] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878461 46878461] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16850 C16850] | ** [http://www.genome.jp/dbget-bin/www_bget?C16850 C16850] | ||
{{#set: smiles=CC(=O)C(O)C(O)CC([N+])C([O-])=O}} | {{#set: smiles=CC(=O)C(O)C(O)CC([N+])C([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=191.183 }} | {{#set: molecular weight=191.183 }} | ||
| + | {{#set: inchi key=InChIKey=IFMHGOADXGYWMO-KVQBGUIXSA-N}} | ||
| + | {{#set: common name=2-amino-3,7-dideoxy-D-threo-hept-6-ulosonate}} | ||
{{#set: common name=ADTH|2-amino-2,3,7-trideoxy-D-lyxo-hept-6-ulosonic acid}} | {{#set: common name=ADTH|2-amino-2,3,7-trideoxy-D-lyxo-hept-6-ulosonic acid}} | ||
{{#set: consumed by=RXN-10032}} | {{#set: consumed by=RXN-10032}} | ||
Latest revision as of 11:36, 10 January 2019
Contents
Metabolite CPD-10792
- smiles:
- CC(=O)C(O)C(O)CC([N+])C([O-])=O
- molecular weight:
- 191.183
- inchi key:
- InChIKey=IFMHGOADXGYWMO-KVQBGUIXSA-N
- common name:
- 2-amino-3,7-dideoxy-D-threo-hept-6-ulosonate
- Synonym(s):
- ADTH
- 2-amino-2,3,7-trideoxy-D-lyxo-hept-6-ulosonic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)C(O)C(O)CC([N+])C([O-])=O" cannot be used as a page name in this wiki.
