Difference between revisions of "CPD0-2338"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2338 CPD0-2338] == * smiles: ** C(NC(N)=O)=CC(=O)OO * common name: ** (Z)-3-ureidoacrylate...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(NC(N)=O)=CC(=O)OO | ** C(NC(N)=O)=CC(=O)OO | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 146.102 | ** 146.102 | ||
| + | * inchi key: | ||
| + | ** InChIKey=AJFKXWQDHFYKFK-UPHRSURJSA-N | ||
| + | * common name: | ||
| + | ** (Z)-3-ureidoacrylate peracid | ||
* Synonym(s): | * Synonym(s): | ||
** ureidoacrylate peracid | ** ureidoacrylate peracid | ||
| Line 16: | Line 16: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN0-6460]] | * [[RXN0-6460]] | ||
| + | * [[RXN-12894]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59889 59889] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59889 59889] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173244 46173244] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173244 46173244] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C20231 C20231] | ||
{{#set: smiles=C(NC(N)=O)=CC(=O)OO}} | {{#set: smiles=C(NC(N)=O)=CC(=O)OO}} | ||
| − | |||
| − | |||
{{#set: molecular weight=146.102 }} | {{#set: molecular weight=146.102 }} | ||
| + | {{#set: inchi key=InChIKey=AJFKXWQDHFYKFK-UPHRSURJSA-N}} | ||
| + | {{#set: common name=(Z)-3-ureidoacrylate peracid}} | ||
{{#set: common name=ureidoacrylate peracid|ureidoperacrylic acid|(2Z)-3-(carbamoylamino)prop-2-eneperoxoic acid|peroxy ureidoacrylate}} | {{#set: common name=ureidoacrylate peracid|ureidoperacrylic acid|(2Z)-3-(carbamoylamino)prop-2-eneperoxoic acid|peroxy ureidoacrylate}} | ||
| − | {{#set: consumed by= | + | {{#set: consumed by=RXN0-6460|RXN-12894}} |
Latest revision as of 11:48, 10 January 2019
Contents
Metabolite CPD0-2338
- smiles:
- C(NC(N)=O)=CC(=O)OO
- molecular weight:
- 146.102
- inchi key:
- InChIKey=AJFKXWQDHFYKFK-UPHRSURJSA-N
- common name:
- (Z)-3-ureidoacrylate peracid
- Synonym(s):
- ureidoacrylate peracid
- ureidoperacrylic acid
- (2Z)-3-(carbamoylamino)prop-2-eneperoxoic acid
- peroxy ureidoacrylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
