Difference between revisions of "CPD0-1028"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == | ||
* smiles: | * smiles: | ||
| − | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP | + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
** 447.424 | ** 447.424 | ||
| + | * inchi key: | ||
| + | ** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K | ||
| + | * common name: | ||
| + | ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate | ||
* Synonym(s): | * Synonym(s): | ||
** di-trans,poly-cis-geranylgeranyl diphosphate | ** di-trans,poly-cis-geranylgeranyl diphosphate | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
* [[RXN0-5180]] | * [[RXN0-5180]] | ||
| + | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356] | ** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356] | ||
| − | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP | + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C}} |
| − | + | ||
| − | + | ||
{{#set: molecular weight=447.424 }} | {{#set: molecular weight=447.424 }} | ||
| + | {{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}} | ||
| + | {{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}} | ||
{{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}} | {{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}} | ||
| − | {{#set: | + | {{#set: produced by=RXN0-5180}} |
Latest revision as of 11:51, 10 January 2019
Contents
Metabolite CPD0-1028
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C
- molecular weight:
- 447.424
- inchi key:
- InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
- common name:
- 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
- Synonym(s):
- di-trans,poly-cis-geranylgeranyl diphosphate
- ω,E,E,Z-geranylgeranyl diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.
