Difference between revisions of "CPD-7414"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] == * smiles: ** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2) | ** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 536.882 | ** 536.882 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N | ||
| + | * common name: | ||
| + | ** ε-carotene | ||
* Synonym(s): | * Synonym(s): | ||
** ε,ε-carotene | ** ε,ε-carotene | ||
| Line 22: | Line 22: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16276 C16276] | ** [http://www.genome.jp/dbget-bin/www_bget?C16276 C16276] | ||
{{#set: smiles=CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)}} | {{#set: smiles=CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=536.882 }} | {{#set: molecular weight=536.882 }} | ||
| + | {{#set: inchi key=InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N}} | ||
| + | {{#set: common name=ε-carotene}} | ||
{{#set: common name=ε,ε-carotene}} | {{#set: common name=ε,ε-carotene}} | ||
{{#set: produced by=RXN-8028}} | {{#set: produced by=RXN-8028}} | ||
Latest revision as of 12:02, 10 January 2019
Contents
Metabolite CPD-7414
- smiles:
- CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
- molecular weight:
- 536.882
- inchi key:
- InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
- common name:
- ε-carotene
- Synonym(s):
- ε,ε-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
