Difference between revisions of "CPD-730"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == * smiles: ** CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1) * common name: ** 3-oxo-...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == | ||
* smiles: | * smiles: | ||
| − | ** CCC=CCC1(C(=O) | + | ** CCC=CCC1(C(CCC(=O)1)CCCCCCCC([O-])=O) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
** 293.425 | ** 293.425 | ||
| + | * inchi key: | ||
| + | ** InChIKey=BZXZFDKIRZBJEP-JMTMCXQRSA-M | ||
| + | * common name: | ||
| + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate | ||
* Synonym(s): | * Synonym(s): | ||
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid | ||
| Line 21: | Line 21: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49265 49265] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49265 49265] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=126961123 126961123] | ||
| + | * HMDB : HMDB36217 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04780 C04780] | ** [http://www.genome.jp/dbget-bin/www_bget?C04780 C04780] | ||
| − | {{#set: smiles=CCC=CCC1(C(=O) | + | * LIPID_MAPS : LMFA02010006 |
| − | + | {{#set: smiles=CCC=CCC1(C(CCC(=O)1)CCCCCCCC([O-])=O)}} | |
| − | + | ||
{{#set: molecular weight=293.425 }} | {{#set: molecular weight=293.425 }} | ||
| + | {{#set: inchi key=InChIKey=BZXZFDKIRZBJEP-JMTMCXQRSA-M}} | ||
| + | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}} | ||
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid|oxopentenyl-cyclopentane-octanoic acid|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate|OPC8|OPC-8:0}} | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid|oxopentenyl-cyclopentane-octanoic acid|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate|OPC8|OPC-8:0}} | ||
{{#set: produced by=12-OXOPHYTODIENOATE-REDUCTASE-RXN}} | {{#set: produced by=12-OXOPHYTODIENOATE-REDUCTASE-RXN}} | ||
Latest revision as of 13:17, 10 January 2019
Contents
Metabolite CPD-730
- smiles:
- CCC=CCC1(C(CCC(=O)1)CCCCCCCC([O-])=O)
- molecular weight:
- 293.425
- inchi key:
- InChIKey=BZXZFDKIRZBJEP-JMTMCXQRSA-M
- common name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
- Synonym(s):
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid
- oxopentenyl-cyclopentane-octanoic acid
- 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate
- OPC8
- OPC-8:0
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC1(C(CCC(=O)1)CCCCCCCC([O-])=O)" cannot be used as a page name in this wiki.
"8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate" cannot be used as a page name in this wiki.
