Difference between revisions of "CPD-14808"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * common name: ** scyllo-inosose...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C(C(C(C(C1O)O)=O)O)O)O | ** C1(C(C(C(C(C1O)O)=O)O)O)O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 178.141 | ** 178.141 | ||
| + | * inchi key: | ||
| + | ** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N | ||
| + | * common name: | ||
| + | ** scyllo-inosose | ||
* Synonym(s): | * Synonym(s): | ||
** 2-keto-myo-inositol | ** 2-keto-myo-inositol | ||
| Line 21: | Line 21: | ||
* [[RXN-13779]] | * [[RXN-13779]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294] | ||
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}} | {{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=178.141 }} | {{#set: molecular weight=178.141 }} | ||
| + | {{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}} | ||
| + | {{#set: common name=scyllo-inosose}} | ||
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}} | {{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}} | ||
{{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN|RXN-13779}} | {{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN|RXN-13779}} | ||
Latest revision as of 12:25, 10 January 2019
Contents
Metabolite CPD-14808
- smiles:
- C1(C(C(C(C(C1O)O)=O)O)O)O
- molecular weight:
- 178.141
- inchi key:
- InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
- common name:
- scyllo-inosose
- Synonym(s):
- 2-keto-myo-inositol
- 2,4,6/3,5-pentahydroxycyclohexanone
- 2-inosose
- 2-keto-scyllo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
