Difference between revisions of "CPD-11877"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11877 CPD-11877] == * smiles: ** C[N+]CC(O)C1(C=CC(O)=C(OC)C=1) * common name: ** metanephr...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C[N+]CC(O)C1(C=CC(O)=C(OC)C=1) | ** C[N+]CC(O)C1(C=CC(O)=C(OC)C=1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 198.241 | ** 198.241 | ||
| + | * inchi key: | ||
| + | ** InChIKey=JWJCTZKFYGDABJ-VIFPVBQESA-O | ||
| + | * common name: | ||
| + | ** metanephrine | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=144365 144365] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6921592 6921592] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6921592 6921592] | ||
| − | |||
| − | |||
* HMDB : HMDB04063 | * HMDB : HMDB04063 | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05588 C05588] | ** [http://www.genome.jp/dbget-bin/www_bget?C05588 C05588] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.19844.html 19844] | ||
{{#set: smiles=C[N+]CC(O)C1(C=CC(O)=C(OC)C=1)}} | {{#set: smiles=C[N+]CC(O)C1(C=CC(O)=C(OC)C=1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=198.241 }} | {{#set: molecular weight=198.241 }} | ||
| + | {{#set: inchi key=InChIKey=JWJCTZKFYGDABJ-VIFPVBQESA-O}} | ||
| + | {{#set: common name=metanephrine}} | ||
{{#set: consumed by=RXN-10913}} | {{#set: consumed by=RXN-10913}} | ||
Latest revision as of 12:28, 10 January 2019
Contents
Metabolite CPD-11877
- smiles:
- C[N+]CC(O)C1(C=CC(O)=C(OC)C=1)
- molecular weight:
- 198.241
- inchi key:
- InChIKey=JWJCTZKFYGDABJ-VIFPVBQESA-O
- common name:
- metanephrine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+]CC(O)C1(C=CC(O)=C(OC)C=1)" cannot be used as a page name in this wiki.
