Difference between revisions of "IMINOASPARTATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * common name: ** 2-i...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)([O-])CC(=N)C(=O)[O-] | ** C(=O)([O-])CC(=N)C(=O)[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 129.072 | ** 129.072 | ||
| + | * inchi key: | ||
| + | ** InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L | ||
| + | * common name: | ||
| + | ** 2-iminosuccinate | ||
* Synonym(s): | * Synonym(s): | ||
** 2-iminobutanedioate | ** 2-iminobutanedioate | ||
| Line 21: | Line 21: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.19951415.html 19951415] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615393 23615393] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615393 23615393] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58831 58831] | ||
* HMDB : HMDB01131 | * HMDB : HMDB01131 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05840 C05840] | ** [http://www.genome.jp/dbget-bin/www_bget?C05840 C05840] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* BIGG : iasp | * BIGG : iasp | ||
{{#set: smiles=C(=O)([O-])CC(=N)C(=O)[O-]}} | {{#set: smiles=C(=O)([O-])CC(=N)C(=O)[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=129.072 }} | {{#set: molecular weight=129.072 }} | ||
| + | {{#set: inchi key=InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=2-iminosuccinate}} | ||
{{#set: common name=2-iminobutanedioate|α-iminosuccinate|iminoaspartate}} | {{#set: common name=2-iminobutanedioate|α-iminosuccinate|iminoaspartate}} | ||
{{#set: consumed by=QUINOLINATE-SYNTHA-RXN}} | {{#set: consumed by=QUINOLINATE-SYNTHA-RXN}} | ||
{{#set: produced by=L-ASPARTATE-OXID-RXN|RXN-9772}} | {{#set: produced by=L-ASPARTATE-OXID-RXN|RXN-9772}} | ||
Latest revision as of 13:30, 10 January 2019
Contents
Metabolite IMINOASPARTATE
- smiles:
- C(=O)([O-])CC(=N)C(=O)[O-]
- molecular weight:
- 129.072
- inchi key:
- InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L
- common name:
- 2-iminosuccinate
- Synonym(s):
- 2-iminobutanedioate
- α-iminosuccinate
- iminoaspartate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CC(=N)C(=O)[O-" cannot be used as a page name in this wiki.
