Difference between revisions of "CPD-13404"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13404 CPD-13404] == * smiles: ** CC([N+])C(NC(CC(=O)[O-])C(=O)[O-])=O * common name: ** L-a...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC([N+])C(NC(CC(=O)[O-])C(=O)[O-])=O | ** CC([N+])C(NC(CC(=O)[O-])C(=O)[O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 203.174 | ** 203.174 | ||
| + | * inchi key: | ||
| + | ** InChIKey=XAEWTDMGFGHWFK-IMJSIDKUSA-M | ||
| + | * common name: | ||
| + | ** L-alanyl-L-aspartate | ||
* Synonym(s): | * Synonym(s): | ||
** ala-asp | ** ala-asp | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.5362971.html 5362971] | ** [http://www.chemspider.com/Chemical-Structure.5362971.html 5362971] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74363 74363] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74363 74363] | ||
| + | * CAS : 20727-65-5 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6995001 6995001] | ||
{{#set: smiles=CC([N+])C(NC(CC(=O)[O-])C(=O)[O-])=O}} | {{#set: smiles=CC([N+])C(NC(CC(=O)[O-])C(=O)[O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=203.174 }} | {{#set: molecular weight=203.174 }} | ||
| + | {{#set: inchi key=InChIKey=XAEWTDMGFGHWFK-IMJSIDKUSA-M}} | ||
| + | {{#set: common name=L-alanyl-L-aspartate}} | ||
{{#set: common name=ala-asp}} | {{#set: common name=ala-asp}} | ||
{{#set: consumed by=RXN0-6975}} | {{#set: consumed by=RXN0-6975}} | ||
Latest revision as of 12:35, 10 January 2019
Contents
Metabolite CPD-13404
- smiles:
- CC([N+])C(NC(CC(=O)[O-])C(=O)[O-])=O
- molecular weight:
- 203.174
- inchi key:
- InChIKey=XAEWTDMGFGHWFK-IMJSIDKUSA-M
- common name:
- L-alanyl-L-aspartate
- Synonym(s):
- ala-asp
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC([N+])C(NC(CC(=O)[O-])C(=O)[O-])=O" cannot be used as a page name in this wiki.
