Difference between revisions of "CPD-9865"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9865 CPD-9865] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C)C)C | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C)C)C | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 805.321 | ** 805.321 | ||
+ | * inchi key: | ||
+ | ** InChIKey=FYLLWSGFAAQKHU-GBBROCKZSA-N | ||
+ | * common name: | ||
+ | ** 6-(all-trans-decaprenyl)-2-methoxy-phenol | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[RXN-9233]] | * [[RXN-9233]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * METABOLIGHTS : MTBLC50774 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25010760 25010760] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25010760 25010760] | ||
+ | * HMDB : HMDB60250 | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50774 50774] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50774 50774] | ||
− | |||
− | |||
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C)C)C}} | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C)C)C}} | ||
− | |||
− | |||
{{#set: molecular weight=805.321 }} | {{#set: molecular weight=805.321 }} | ||
− | {{#set: | + | {{#set: inchi key=InChIKey=FYLLWSGFAAQKHU-GBBROCKZSA-N}} |
− | {{#set: produced by= | + | {{#set: common name=6-(all-trans-decaprenyl)-2-methoxy-phenol}} |
+ | {{#set: produced by=RXN-9233}} |
Latest revision as of 12:41, 10 January 2019
Contents
Metabolite CPD-9865
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C)C)C
- molecular weight:
- 805.321
- inchi key:
- InChIKey=FYLLWSGFAAQKHU-GBBROCKZSA-N
- common name:
- 6-(all-trans-decaprenyl)-2-methoxy-phenol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links