Difference between revisions of "CPD-16458"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * smiles: ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) * common name: ** 7,8-dihyd...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) | ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 166.139 | ** 166.139 | ||
| + | * inchi key: | ||
| + | ** InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** 7,8-dihydrolumazine | ||
* Synonym(s): | * Synonym(s): | ||
| Line 19: | Line 19: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=590555 590555] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=590555 590555] | ||
{{#set: smiles=C2(=O)(C1(=C(NCC=N1)NC(=O)N2))}} | {{#set: smiles=C2(=O)(C1(=C(NCC=N1)NC(=O)N2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=166.139 }} | {{#set: molecular weight=166.139 }} | ||
| + | {{#set: inchi key=InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=7,8-dihydrolumazine}} | ||
{{#set: produced by=RXN-15261}} | {{#set: produced by=RXN-15261}} | ||
Latest revision as of 13:00, 10 January 2019
Contents
Metabolite CPD-16458
- smiles:
- C2(=O)(C1(=C(NCC=N1)NC(=O)N2))
- molecular weight:
- 166.139
- inchi key:
- InChIKey=MYJNEEHZESREMO-UHFFFAOYSA-N
- common name:
- 7,8-dihydrolumazine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
